Chemical Formula:
|
Pb12O6Mn(Mg,Mn)2(Mn,Mg)4(SO4)(CO3)4Cl4(OH)12 |
Composition:
|
Molecular Weight = 3587.7 g |
|
|
|
Hydrogen |
0.34 % |
H |
3.01 % |
H2O |
0.00 % |
|
|
|
Carbon |
1.34 % |
C |
4.91 % |
CO2 |
0.00 % |
|
|
|
Oxygen |
15.16 % |
O |
0.00 % |
|
0.00 % |
|
|
|
Magnesium |
1.35 % |
Mg |
2.25 % |
MgO |
0.00 % |
|
|
|
Sulfur |
0.89 % |
S |
2.23 % |
SO3 |
0.00 % |
|
|
|
Chlorine |
3.95 % |
Cl |
3.95 % |
Cl |
0.00 % |
|
|
|
Manganese |
7.66 % |
Mn |
9.89 % |
MnO |
0.00 % |
|
|
|
Lead |
69.30 % |
Pb |
74.65 % |
PbO |
0.00 % |
|
|
|
|
|
|
|
|
|
|
|
|
|
99.99 % |
|
100.89 % |
|
|
|
|
| |
Empirical Formula:
|
Pb12O6Mg2Mn2+5(SO4)(CO3)4(OH)12Cl4 |
|
Environment:
|
Crust-like overgrowths and simple tetragonal tablets on subhedral lead, and on lead wire in a calcite-rich Mn oxide ore matrix. A late-stage fissure mineral in a skarn assemblage |
|
Locality:
|
Langban, Varmland, Sweden.. Link to
MinDat.org
Location Data.
|
|
Name Origin:
|
The name is from the Greek philos (=loving) and lithos (=stone) in honor of the Friends of Mineralogy |
|
Synonym:
|
IMA1996-020 |
|